C13H18N2O4 — CID 138667500
1-[2-(2,5-dioxopyrrolidin-1-yl)butan-2-yl]piperidine-2,6-dione (PubChem CID 138667500) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrolidin-1-yl)butan-2-yl]piperidine-2,6-dione.
| Compound Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)butan-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138667500 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)butan-2-yl]piperidine-2,6-dione |
| SMILES | CCC(C)(N1C(=O)CCCC1=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C13H18N2O4/c1-3-13(2,15-11(18)7-8-12(15)19)14-9(16)5-4-6-10(14)17/h3-8H2,1-2H3 |
| InChIKey | HJQOKJJWWQQXOC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|