C9H14N2O2S — CID 61123128
2-(2,5-dioxopyrrolidin-1-yl)-2-methylbutanethioamide (PubChem CID 61123128) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-2-methylbutanethioamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 61123128 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-2-methylbutanethioamide |
| SMILES | CCC(C)(C(N)=S)N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-3-9(2,8(10)14)11-6(12)4-5-7(11)13/h3-5H2,1-2H3,(H2,10,14) |
| InChIKey | YJDVZVSSQGRCJQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|