C15H14BrFNO3PS — CID 138667675
4-bromo-2-fluoro-5-[(5-methoxy-3-pyridinyl)oxy]-2-(phosphanylmethyl)-3H-1-benzothiophen-3-ol (PubChem CID 138667675) has the molecular formula C15H14BrFNO3PS and a molecular weight of 418.22 g/mol. Its IUPAC name is 4-bromo-2-fluoro-5-[(5-methoxy-3-pyridinyl)oxy]-2-(phosphanylmethyl)-3H-1-benzothiophen-3-ol.
| Compound Name | 4-bromo-2-fluoro-5-[(5-methoxy-3-pyridinyl)oxy]-2-(phosphanylmethyl)-3H-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 138667675 |
| Molecular Formula | C15H14BrFNO3PS |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 4-bromo-2-fluoro-5-[(5-methoxy-3-pyridinyl)oxy]-2-(phosphanylmethyl)-3H-1-benzothiophen-3-ol |
| SMILES | COc1cncc(Oc2ccc3c(c2Br)C(O)C(F)(CP)S3)c1 |
| InChI | InChI=1S/C15H14BrFNO3PS/c1-20-8-4-9(6-18-5-8)21-10-2-3-11-12(13(10)16)14(19)15(17,7-22)23-11/h2-6,14,19H,7,22H2,1H3 |
| InChIKey | XFTUIJJGXWIUBL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|