C27H30FNO2 — CID 138667876
1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-[2-(4-fluorophenyl)phenyl]pentan-1-one (PubChem CID 138667876) has the molecular formula C27H30FNO2 and a molecular weight of 419.54 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-[2-(4-fluorophenyl)phenyl]pentan-1-one.
| Compound Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-[2-(4-fluorophenyl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 138667876 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-[2-(4-fluorophenyl)phenyl]pentan-1-one |
| SMILES | CCCC(C(=O)c1ccc(OCCN(C)C)cc1)c1ccccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30FNO2/c1-4-7-26(25-9-6-5-8-24(25)20-10-14-22(28)15-11-20)27(30)21-12-16-23(17-13-21)31-19-18-29(2)3/h5-6,8-17,26H,4,7,18-19H2,1-3H3 |
| InChIKey | ZYBLMSMNDXLDEJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |