C34H43ClN2O6S — CID 138670594
US10821115, Example 100102 (PubChem CID 138670594) has the molecular formula C34H43ClN2O6S and a molecular weight of 643.25 g/mol.
| Compound Name | US10821115, Example 100102 |
|---|---|
| PubChem CID | 138670594 |
| Molecular Formula | C34H43ClN2O6S |
| Molecular Weight | 643.25 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[C@@H](C)CCCC2(OCCO2)[C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS1(=O)=O |
| InChI | InChI=1S/C34H43ClN2O6S/c1-22-5-3-14-34(42-15-16-43-34)29-10-7-26(29)19-37-20-33(13-4-6-24-17-27(35)9-11-28(24)33)21-41-31-12-8-25(18-30(31)37)32(38)36-44(39,40)23(22)2/h8-9,11-12,17-18,22-23,26,29H,3-7,10,13-16,19-21H2,1-2H3,(H,36,38)/t22-,23+,26-,29+,33-/m0/s1 |
| InChIKey | FGRRMGUNTZIPKD-JKFHHUPCSA-N |
| XLogP | 5.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.25 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |