C70H92Cl2N6O10S2 — CID 160805198
CID 160805198 (PubChem CID 160805198) has the molecular formula C70H92Cl2N6O10S2 and a molecular weight of 1312.58 g/mol.
| Compound Name | CID 160805198 |
|---|---|
| PubChem CID | 160805198 |
| Molecular Formula | C70H92Cl2N6O10S2 |
| Molecular Weight | 1312.58 g/mol |
| Exact Mass | 1310.57 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@@]2(COCCN2)[C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS1(=O)=O.C[C@@H]1[C@@H](C)CCC[C@@]2(COCCN2)[C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS1(=O)=O |
| InChI | InChI=1S/2C35H46ClN3O5S/c2*1-23-5-3-14-35(22-43-16-15-37-35)30-10-7-27(30)19-39-20-34(13-4-6-25-17-28(36)9-11-29(25)34)21-44-32-12-8-26(18-31(32)39)33(40)38-45(41,42)24(23)2/h2*8-9,11-12,17-18,23-24,27,30,37H,3-7,10,13-16,19-22H2,1-2H3,(H,38,40)/t2*23-,24+,27-,30+,34-,35+/m00/s1 |
| InChIKey | SDPCQXABWWOJCL-NPKANHGVSA-N |
| XLogP | 10.93 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1312.58 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |