C42H27N5O — CID 138670998
2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyldibenzofuran-1-yl]-4-phenylquinazoline (PubChem CID 138670998) has the molecular formula C42H27N5O and a molecular weight of 617.71 g/mol. Its IUPAC name is 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyldibenzofuran-1-yl]-4-phenylquinazoline.
| Compound Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyldibenzofuran-1-yl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 138670998 |
| Molecular Formula | C42H27N5O |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyldibenzofuran-1-yl]-4-phenylquinazoline |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)c3ccccc3n2)c2c(c1)oc1ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C42H27N5O/c1-26-23-33(42-43-34-20-12-11-19-31(34)38(44-42)27-13-5-2-6-14-27)37-32-25-30(21-22-35(32)48-36(37)24-26)41-46-39(28-15-7-3-8-16-28)45-40(47-41)29-17-9-4-10-18-29/h2-25H,1H3 |
| InChIKey | ARRVVZOAHLWRPF-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |