C25H34F2N4O4 — CID 138671873
N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(3-methoxy-1,2-oxazol-5-yl)acetamide (PubChem CID 138671873) has the molecular formula C25H34F2N4O4 and a molecular weight of 492.57 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(3-methoxy-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(3-methoxy-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 138671873 |
| Molecular Formula | C25H34F2N4O4 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(3-methoxy-1,2-oxazol-5-yl)acetamide |
| SMILES | COc1cc(CC(=O)NC2CCC(CCN3CCc4ccc(OCC(F)F)nc4CC3)CC2)on1 |
| InChI | InChI=1S/C25H34F2N4O4/c1-33-25-15-20(35-30-25)14-23(32)28-19-5-2-17(3-6-19)8-11-31-12-9-18-4-7-24(34-16-22(26)27)29-21(18)10-13-31/h4,7,15,17,19,22H,2-3,5-6,8-14,16H2,1H3,(H,28,32) |
| InChIKey | KLQIHPAHWKUONZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |