C25H33F3N4O3 — CID 138671111
2-(2-methyl-1,3-oxazol-5-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide (PubChem CID 138671111) has the molecular formula C25H33F3N4O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 2-(2-methyl-1,3-oxazol-5-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(2-methyl-1,3-oxazol-5-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138671111 |
| Molecular Formula | C25H33F3N4O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-(2-methyl-1,3-oxazol-5-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
| SMILES | Cc1ncc(CC(=O)NC2CCC(CCN3CCc4ccc(OCC(F)(F)F)nc4CC3)CC2)o1 |
| InChI | InChI=1S/C25H33F3N4O3/c1-17-29-15-21(35-17)14-23(33)30-20-5-2-18(3-6-20)8-11-32-12-9-19-4-7-24(31-22(19)10-13-32)34-16-25(26,27)28/h4,7,15,18,20H,2-3,5-6,8-14,16H2,1H3,(H,30,33) |
| InChIKey | HFJRSLGOIBDKRH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |