C28H34F3N5O2 — CID 162573603
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]imidazo[1,2-a]pyridine-5-carboxamide (PubChem CID 162573603) has the molecular formula C28H34F3N5O2 and a molecular weight of 529.61 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]imidazo[1,2-a]pyridine-5-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]imidazo[1,2-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 162573603 |
| Molecular Formula | C28H34F3N5O2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]imidazo[1,2-a]pyridine-5-carboxamide |
| SMILES | Cc1cn2c(C(=O)NC3CCC(CCN4CCc5ccc(OCC(F)(F)F)nc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C28H34F3N5O2/c1-19-17-36-24(3-2-4-25(36)32-19)27(37)33-22-8-5-20(6-9-22)11-14-35-15-12-21-7-10-26(34-23(21)13-16-35)38-18-28(29,30)31/h2-4,7,10,17,20,22H,5-6,8-9,11-16,18H2,1H3,(H,33,37) |
| InChIKey | AHOOQQBQILSKBU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |