C26H32F4N4O3 — CID 138671522
N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-1-methyl-6-oxopyridine-2-carboxamide (PubChem CID 138671522) has the molecular formula C26H32F4N4O3 and a molecular weight of 524.56 g/mol. Its IUPAC name is N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-1-methyl-6-oxopyridine-2-carboxamide.
| Compound Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-1-methyl-6-oxopyridine-2-carboxamide |
|---|---|
| PubChem CID | 138671522 |
| Molecular Formula | C26H32F4N4O3 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-1-methyl-6-oxopyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCC(F)(CCN3CCc4ccc(OCC(F)(F)F)nc4CC3)CC2)cccc1=O |
| InChI | InChI=1S/C26H32F4N4O3/c1-33-21(3-2-4-23(33)35)24(36)31-19-7-11-25(27,12-8-19)13-16-34-14-9-18-5-6-22(32-20(18)10-15-34)37-17-26(28,29)30/h2-6,19H,7-17H2,1H3,(H,31,36) |
| InChIKey | SMKBJUWMOGGJNZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |