C29H34F5N5O — CID 155791936
7-fluoro-N-[4-fluoro-4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide (PubChem CID 155791936) has the molecular formula C29H34F5N5O and a molecular weight of 563.62 g/mol. Its IUPAC name is 7-fluoro-N-[4-fluoro-4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide.
| Compound Name | 7-fluoro-N-[4-fluoro-4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 155791936 |
| Molecular Formula | C29H34F5N5O |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 7-fluoro-N-[4-fluoro-4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NC3CCC(F)(CCN4CCc5ccc(CCC(F)(F)F)nc5CC4)CC3)ccc(F)c2n1 |
| InChI | InChI=1S/C29H34F5N5O/c1-38-18-23-22(4-5-24(30)26(23)37-38)27(40)36-21-6-11-28(31,12-7-21)14-17-39-15-9-19-2-3-20(8-13-29(32,33)34)35-25(19)10-16-39/h2-5,18,21H,6-17H2,1H3,(H,36,40) |
| InChIKey | LSPAUXRXDRUAFX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |