C28H32F4N4O3 — CID 138670360
N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methyl-1,3-benzoxazole-5-carboxamide (PubChem CID 138670360) has the molecular formula C28H32F4N4O3 and a molecular weight of 548.58 g/mol. Its IUPAC name is N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 138670360 |
| Molecular Formula | C28H32F4N4O3 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methyl-1,3-benzoxazole-5-carboxamide |
| SMILES | Cc1nc2cc(C(=O)NC3CCC(F)(CCN4CCc5ccc(OCC(F)(F)F)nc5CC4)CC3)ccc2o1 |
| InChI | InChI=1S/C28H32F4N4O3/c1-18-33-23-16-20(2-4-24(23)39-18)26(37)34-21-6-10-27(29,11-7-21)12-15-36-13-8-19-3-5-25(35-22(19)9-14-36)38-17-28(30,31)32/h2-5,16,21H,6-15,17H2,1H3,(H,34,37) |
| InChIKey | QCMGDJORQRDIOP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |