C21H27F3N4O4 — CID 138671169
2-[(5-methyl-1,2-oxazol-3-yl)oxy]-N-[4-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]butyl]acetamide (PubChem CID 138671169) has the molecular formula C21H27F3N4O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)oxy]-N-[4-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]butyl]acetamide.
| Compound Name | 2-[(5-methyl-1,2-oxazol-3-yl)oxy]-N-[4-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]butyl]acetamide |
|---|---|
| PubChem CID | 138671169 |
| Molecular Formula | C21H27F3N4O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[(5-methyl-1,2-oxazol-3-yl)oxy]-N-[4-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]butyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NCCCCN2CCc3ccc(OCC(F)(F)F)nc3CC2)no1 |
| InChI | InChI=1S/C21H27F3N4O4/c1-15-12-20(27-32-15)30-13-18(29)25-8-2-3-9-28-10-6-16-4-5-19(26-17(16)7-11-28)31-14-21(22,23)24/h4-5,12H,2-3,6-11,13-14H2,1H3,(H,25,29) |
| InChIKey | QTMMHKANWXBXBH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|