C20H26F6N2O2 — CID 152985056
1,1,1-trifluoro-9-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]nonan-4-one (PubChem CID 152985056) has the molecular formula C20H26F6N2O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 1,1,1-trifluoro-9-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]nonan-4-one.
| Compound Name | 1,1,1-trifluoro-9-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]nonan-4-one |
|---|---|
| PubChem CID | 152985056 |
| Molecular Formula | C20H26F6N2O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1,1,1-trifluoro-9-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]nonan-4-one |
| SMILES | O=C(CCCCCN1CCc2ccc(OCC(F)(F)F)nc2CC1)CCC(F)(F)F |
| InChI | InChI=1S/C20H26F6N2O2/c21-19(22,23)10-7-16(29)4-2-1-3-11-28-12-8-15-5-6-18(27-17(15)9-13-28)30-14-20(24,25)26/h5-6H,1-4,7-14H2 |
| InChIKey | UVDMKEKYBSXUST-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|