C25H34F5N3O2 — CID 145451469
N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-4,4,4-trifluorobutanamide (PubChem CID 145451469) has the molecular formula C25H34F5N3O2 and a molecular weight of 503.56 g/mol. Its IUPAC name is N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-4,4,4-trifluorobutanamide.
| Compound Name | N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 145451469 |
| Molecular Formula | C25H34F5N3O2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-4,4,4-trifluorobutanamide |
| SMILES | CC(F)(F)COc1ccc2c(n1)CCN(CCC1CCC(/C=N/C(=O)CCC(F)(F)F)CC1)CC2 |
| InChI | InChI=1S/C25H34F5N3O2/c1-24(26,27)17-35-23-7-6-20-10-14-33(15-11-21(20)32-23)13-9-18-2-4-19(5-3-18)16-31-22(34)8-12-25(28,29)30/h6-7,16,18-19H,2-5,8-15,17H2,1H3/b31-16+ |
| InChIKey | CIZAVFVEYKNOAF-WCMJOSRZSA-N |
| XLogP | 5.65 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|