C30H35F4N5O — CID 155347501
7-fluoro-2-methyl-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]indazole-4-carboxamide (PubChem CID 155347501) has the molecular formula C30H35F4N5O and a molecular weight of 557.64 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]indazole-4-carboxamide.
| Compound Name | 7-fluoro-2-methyl-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]indazole-4-carboxamide |
|---|---|
| PubChem CID | 155347501 |
| Molecular Formula | C30H35F4N5O |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 7-fluoro-2-methyl-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]indazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)/N=C/C3CCC(CCN4CCc5ccc(CCC(F)(F)F)nc5CC4)CC3)ccc(F)c2n1 |
| InChI | InChI=1S/C30H35F4N5O/c1-38-19-25-24(8-9-26(31)28(25)37-38)29(40)35-18-21-4-2-20(3-5-21)11-15-39-16-12-22-6-7-23(10-14-30(32,33)34)36-27(22)13-17-39/h6-9,18-21H,2-5,10-17H2,1H3/b35-18+ |
| InChIKey | FUQYWNQSBTZVIT-MWBNBJEGSA-N |
| XLogP | 6.11 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|