C24H32F3N5O2S2 — CID 155347478
2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]acetamide (PubChem CID 155347478) has the molecular formula C24H32F3N5O2S2 and a molecular weight of 543.68 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]acetamide.
| Compound Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]acetamide |
|---|---|
| PubChem CID | 155347478 |
| Molecular Formula | C24H32F3N5O2S2 |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]acetamide |
| SMILES | Cc1nnc(CC(=O)/N=C/C2CCC(CCN3CCc4nc(OCCC(F)(F)F)sc4CC3)CC2)s1 |
| InChI | InChI=1S/C24H32F3N5O2S2/c1-16-30-31-22(35-16)14-21(33)28-15-18-4-2-17(3-5-18)6-10-32-11-7-19-20(8-12-32)36-23(29-19)34-13-9-24(25,26)27/h15,17-18H,2-14H2,1H3/b28-15+ |
| InChIKey | UTBBSDUJKIGPHR-RWPZCVJISA-N |
| XLogP | 5.07 |
| TPSA | 80.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|