C23H31F3N4O4S — CID 145451816
2-(5-methyl-2,3-dihydro-1,3-oxazol-2-yl)-N-[[(6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]methylidene]acetamide (PubChem CID 145451816) has the molecular formula C23H31F3N4O4S and a molecular weight of 516.59 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dihydro-1,3-oxazol-2-yl)-N-[[(6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]methylidene]acetamide.
| Compound Name | 2-(5-methyl-2,3-dihydro-1,3-oxazol-2-yl)-N-[[(6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]methylidene]acetamide |
|---|---|
| PubChem CID | 145451816 |
| Molecular Formula | C23H31F3N4O4S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-(5-methyl-2,3-dihydro-1,3-oxazol-2-yl)-N-[[(6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]methylidene]acetamide |
| SMILES | CC1=CNC(CC(=O)/N=C/C2CC[C@H](CCN3CCc4nc(OCC(F)(F)F)sc4CC3)OC2)O1 |
| InChI | InChI=1S/C23H31F3N4O4S/c1-15-11-28-21(34-15)10-20(31)27-12-16-2-3-17(32-13-16)4-7-30-8-5-18-19(6-9-30)35-22(29-18)33-14-23(24,25)26/h11-12,16-17,21,28H,2-10,13-14H2,1H3/b27-12+/t16?,17-,21?/m1/s1 |
| InChIKey | WQFCFQXIGUYLTL-CBRRFECKSA-N |
| XLogP | 3.46 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|