C24H30F3N3O3S — CID 160584299
1-(2-methyl-3-pyridinyl)-2-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]ethanone (PubChem CID 160584299) has the molecular formula C24H30F3N3O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is 1-(2-methyl-3-pyridinyl)-2-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]ethanone.
| Compound Name | 1-(2-methyl-3-pyridinyl)-2-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]ethanone |
|---|---|
| PubChem CID | 160584299 |
| Molecular Formula | C24H30F3N3O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-(2-methyl-3-pyridinyl)-2-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]ethanone |
| SMILES | Cc1ncccc1C(=O)C[C@H]1CC[C@H](CCN2CCc3nc(OCC(F)(F)F)sc3CC2)OC1 |
| InChI | InChI=1S/C24H30F3N3O3S/c1-16-19(3-2-9-28-16)21(31)13-17-4-5-18(32-14-17)6-10-30-11-7-20-22(8-12-30)34-23(29-20)33-15-24(25,26)27/h2-3,9,17-18H,4-8,10-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | RCEMQXWISANPHT-QZTJIDSGSA-N |
| XLogP | 4.65 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |