C24H31F3N4O2S — CID 138671157
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 138671157) has the molecular formula C24H31F3N4O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138671157 |
| Molecular Formula | C24H31F3N4O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC1CCC(CCN2CCc3nc(OCC(F)(F)F)sc3CC2)CC1 |
| InChI | InChI=1S/C24H31F3N4O2S/c1-16-19(3-2-11-28-16)22(32)29-18-6-4-17(5-7-18)8-12-31-13-9-20-21(10-14-31)34-23(30-20)33-15-24(25,26)27/h2-3,11,17-18H,4-10,12-15H2,1H3,(H,29,32) |
| InChIKey | WCUWZYDITZGKIU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |