C25H30F3N5O2S — CID 138671538
N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyrrolo[1,2-b]pyridazine-5-carboxamide (PubChem CID 138671538) has the molecular formula C25H30F3N5O2S and a molecular weight of 521.61 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyrrolo[1,2-b]pyridazine-5-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyrrolo[1,2-b]pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 138671538 |
| Molecular Formula | C25H30F3N5O2S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]pyrrolo[1,2-b]pyridazine-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CCc3nc(OCC(F)(F)F)sc3CC2)CC1)c1ccn2ncccc12 |
| InChI | InChI=1S/C25H30F3N5O2S/c26-25(27,28)16-35-24-31-20-9-13-32(14-10-22(20)36-24)12-7-17-3-5-18(6-4-17)30-23(34)19-8-15-33-21(19)2-1-11-29-33/h1-2,8,11,15,17-18H,3-7,9-10,12-14,16H2,(H,30,34) |
| InChIKey | DLUXSDHIHVKKNM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |