C22H32F5N3O2S — CID 138671869
N-[4-[2-[2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide (PubChem CID 138671869) has the molecular formula C22H32F5N3O2S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 138671869 |
| Molecular Formula | C22H32F5N3O2S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoropropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide |
| SMILES | CC(F)(F)COc1nc2c(s1)CCN(CCC1CCC(NC(=O)CCC(F)(F)F)CC1)CC2 |
| InChI | InChI=1S/C22H32F5N3O2S/c1-21(23,24)14-32-20-29-17-8-12-30(13-9-18(17)33-20)11-7-15-2-4-16(5-3-15)28-19(31)6-10-22(25,26)27/h15-16H,2-14H2,1H3,(H,28,31) |
| InChIKey | RLPUNVGCCFVAOS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |