C23H31F3N4O2S2 — CID 138671941
2-(5-methyl-1,3-thiazol-2-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]acetamide (PubChem CID 138671941) has the molecular formula C23H31F3N4O2S2 and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-(5-methyl-1,3-thiazol-2-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(5-methyl-1,3-thiazol-2-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138671941 |
| Molecular Formula | C23H31F3N4O2S2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-(5-methyl-1,3-thiazol-2-yl)-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]acetamide |
| SMILES | Cc1cnc(CC(=O)NC2CCC(CCN3CCc4nc(OCC(F)(F)F)sc4CC3)CC2)s1 |
| InChI | InChI=1S/C23H31F3N4O2S2/c1-15-13-27-21(33-15)12-20(31)28-17-4-2-16(3-5-17)6-9-30-10-7-18-19(8-11-30)34-22(29-18)32-14-23(24,25)26/h13,16-17H,2-12,14H2,1H3,(H,28,31) |
| InChIKey | OYAWUZKNTRJSCD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |