C22H30F3N5O3S — CID 138671173
2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]acetamide (PubChem CID 138671173) has the molecular formula C22H30F3N5O3S and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]acetamide.
| Compound Name | 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 138671173 |
| Molecular Formula | C22H30F3N5O3S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]acetamide |
| SMILES | Cn1cc(CC(=O)N[C@H]2CC[C@H](CCN3CCc4nc(OCC(F)(F)F)sc4CC3)OC2)cn1 |
| InChI | InChI=1S/C22H30F3N5O3S/c1-29-12-15(11-26-29)10-20(31)27-16-2-3-17(32-13-16)4-7-30-8-5-18-19(6-9-30)34-21(28-18)33-14-22(23,24)25/h11-12,16-17H,2-10,13-14H2,1H3,(H,27,31)/t16-,17+/m0/s1 |
| InChIKey | OSFDMORZYXPTEN-DLBZAZTESA-N |
| XLogP | 2.51 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |