C26H31F3N4O3S — CID 138671500
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-1,3-benzoxazole-5-carboxamide (PubChem CID 138671500) has the molecular formula C26H31F3N4O3S and a molecular weight of 536.62 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 138671500 |
| Molecular Formula | C26H31F3N4O3S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-1,3-benzoxazole-5-carboxamide |
| SMILES | Cc1nc2cc(C(=O)NC3CCC(CCN4CCc5nc(OCC(F)(F)F)sc5CC4)CC3)ccc2o1 |
| InChI | InChI=1S/C26H31F3N4O3S/c1-16-30-21-14-18(4-7-22(21)36-16)24(34)31-19-5-2-17(3-6-19)8-11-33-12-9-20-23(10-13-33)37-25(32-20)35-15-26(27,28)29/h4,7,14,17,19H,2-3,5-6,8-13,15H2,1H3,(H,31,34) |
| InChIKey | UGQPJTOGSBETHH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |