C26H33F2N5O2S — CID 138671347
N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-6-carboxamide (PubChem CID 138671347) has the molecular formula C26H33F2N5O2S and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-6-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-6-carboxamide |
|---|---|
| PubChem CID | 138671347 |
| Molecular Formula | C26H33F2N5O2S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-6-carboxamide |
| SMILES | Cn1cc2ccc(C(=O)NC3CCC(CCN4CCc5nc(OCC(F)F)sc5CC4)CC3)cc2n1 |
| InChI | InChI=1S/C26H33F2N5O2S/c1-32-15-19-5-4-18(14-22(19)31-32)25(34)29-20-6-2-17(3-7-20)8-11-33-12-9-21-23(10-13-33)36-26(30-21)35-16-24(27)28/h4-5,14-15,17,20,24H,2-3,6-13,16H2,1H3,(H,29,34) |
| InChIKey | HPTXIDFVXWZMRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |