C28H38FN5O2S — CID 138671501
N-[4-[2-[2-(2-fluoro-2-methylpropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide (PubChem CID 138671501) has the molecular formula C28H38FN5O2S and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[4-[2-[2-(2-fluoro-2-methylpropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide.
| Compound Name | N-[4-[2-[2-(2-fluoro-2-methylpropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 138671501 |
| Molecular Formula | C28H38FN5O2S |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[4-[2-[2-(2-fluoro-2-methylpropoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NC3CCC(CCN4CCc5nc(OCC(C)(C)F)sc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C28H38FN5O2S/c1-28(2,29)18-36-27-31-24-12-15-34(16-13-25(24)37-27)14-11-19-7-9-20(10-8-19)30-26(35)21-5-4-6-23-22(21)17-33(3)32-23/h4-6,17,19-20H,7-16,18H2,1-3H3,(H,30,35) |
| InChIKey | WPEFJCKNIISAPH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |