C25H31F3N6O2S — CID 138671916
3-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]benzotriazole-4-carboxamide (PubChem CID 138671916) has the molecular formula C25H31F3N6O2S and a molecular weight of 536.62 g/mol. Its IUPAC name is 3-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]benzotriazole-4-carboxamide.
| Compound Name | 3-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]benzotriazole-4-carboxamide |
|---|---|
| PubChem CID | 138671916 |
| Molecular Formula | C25H31F3N6O2S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 3-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]benzotriazole-4-carboxamide |
| SMILES | Cn1nnc2cccc(C(=O)NC3CCC(CCN4CCc5nc(OCC(F)(F)F)sc5CC4)CC3)c21 |
| InChI | InChI=1S/C25H31F3N6O2S/c1-33-22-18(3-2-4-20(22)31-32-33)23(35)29-17-7-5-16(6-8-17)9-12-34-13-10-19-21(11-14-34)37-24(30-19)36-15-25(26,27)28/h2-4,16-17H,5-15H2,1H3,(H,29,35) |
| InChIKey | ULTNWSKVTZSJET-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |