C26H32F3N5O2S — CID 138671253
1-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]indazole-7-carboxamide (PubChem CID 138671253) has the molecular formula C26H32F3N5O2S and a molecular weight of 535.64 g/mol. Its IUPAC name is 1-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]indazole-7-carboxamide.
| Compound Name | 1-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 138671253 |
| Molecular Formula | C26H32F3N5O2S |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 1-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]indazole-7-carboxamide |
| SMILES | Cn1ncc2cccc(C(=O)NC3CCC(CCN4CCc5nc(OCC(F)(F)F)sc5CC4)CC3)c21 |
| InChI | InChI=1S/C26H32F3N5O2S/c1-33-23-18(15-30-33)3-2-4-20(23)24(35)31-19-7-5-17(6-8-19)9-12-34-13-10-21-22(11-14-34)37-25(32-21)36-16-26(27,28)29/h2-4,15,17,19H,5-14,16H2,1H3,(H,31,35) |
| InChIKey | WZAFXSPQZWURLZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |