C26H34F3N3O2S — CID 158106700
1-(2-methyl-4-pyridinyl)-3-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]propan-2-one (PubChem CID 158106700) has the molecular formula C26H34F3N3O2S and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-(2-methyl-4-pyridinyl)-3-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]propan-2-one.
| Compound Name | 1-(2-methyl-4-pyridinyl)-3-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 158106700 |
| Molecular Formula | C26H34F3N3O2S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 1-(2-methyl-4-pyridinyl)-3-[4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]propan-2-one |
| SMILES | Cc1cc(CC(=O)CC2CCC(CCN3CCc4nc(OCC(F)(F)F)sc4CC3)CC2)ccn1 |
| InChI | InChI=1S/C26H34F3N3O2S/c1-18-14-21(6-10-30-18)16-22(33)15-20-4-2-19(3-5-20)7-11-32-12-8-23-24(9-13-32)35-25(31-23)34-17-26(27,28)29/h6,10,14,19-20H,2-5,7-9,11-13,15-17H2,1H3 |
| InChIKey | FPXRXAXWUYRCDB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |