C24H38F3N3O2S — CID 145451960
N-(3-cyclopropylpropoxymethyl)-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexan-1-amine (PubChem CID 145451960) has the molecular formula C24H38F3N3O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is N-(3-cyclopropylpropoxymethyl)-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexan-1-amine.
| Compound Name | N-(3-cyclopropylpropoxymethyl)-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 145451960 |
| Molecular Formula | C24H38F3N3O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-(3-cyclopropylpropoxymethyl)-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexan-1-amine |
| SMILES | FC(F)(F)COc1nc2c(s1)CCN(CCC1CCC(NCOCCCC3CC3)CC1)CC2 |
| InChI | InChI=1S/C24H38F3N3O2S/c25-24(26,27)16-32-23-29-21-10-13-30(14-11-22(21)33-23)12-9-19-5-7-20(8-6-19)28-17-31-15-1-2-18-3-4-18/h18-20,28H,1-17H2 |
| InChIKey | SCNVVTQWAMQSTE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|