C21H29F3N2O3 — CID 157427835
1-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]propan-2-one (PubChem CID 157427835) has the molecular formula C21H29F3N2O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 1-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]propan-2-one.
| Compound Name | 1-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 157427835 |
| Molecular Formula | C21H29F3N2O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[(3R,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CC[C@H](CCN2CCc3ccc(OCC(F)(F)F)nc3CC2)OC1 |
| InChI | InChI=1S/C21H29F3N2O3/c1-15(27)12-16-2-4-18(28-13-16)7-10-26-9-6-17-3-5-20(25-19(17)8-11-26)29-14-21(22,23)24/h3,5,16,18H,2,4,6-14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | BQEBHIRALICXHJ-SJLPKXTDSA-N |
| XLogP | 3.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |