C22H28F3N3O2S — CID 149481701
1-(2-methyl-1,3-thiazol-5-yl)-7-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]heptan-2-one (PubChem CID 149481701) has the molecular formula C22H28F3N3O2S and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-5-yl)-7-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]heptan-2-one.
| Compound Name | 1-(2-methyl-1,3-thiazol-5-yl)-7-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]heptan-2-one |
|---|---|
| PubChem CID | 149481701 |
| Molecular Formula | C22H28F3N3O2S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-5-yl)-7-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]heptan-2-one |
| SMILES | Cc1ncc(CC(=O)CCCCCN2CCc3ccc(OCC(F)(F)F)nc3CC2)s1 |
| InChI | InChI=1S/C22H28F3N3O2S/c1-16-26-14-19(31-16)13-18(29)5-3-2-4-10-28-11-8-17-6-7-21(27-20(17)9-12-28)30-15-22(23,24)25/h6-7,14H,2-5,8-13,15H2,1H3 |
| InChIKey | ZDJSMLCUABITFM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|