C26H35F2N5OS — CID 138671398
N-[4-[2-[2-(3,3-difluoroazetidin-1-yl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 138671398) has the molecular formula C26H35F2N5OS and a molecular weight of 503.66 g/mol. Its IUPAC name is N-[4-[2-[2-(3,3-difluoroazetidin-1-yl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[4-[2-[2-(3,3-difluoroazetidin-1-yl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 138671398 |
| Molecular Formula | C26H35F2N5OS |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[4-[2-[2-(3,3-difluoroazetidin-1-yl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ncc(CC(=O)NC2CCC(CCN3CCc4ccc(N5CC(F)(F)C5)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C26H35F2N5OS/c1-18-29-15-22(35-18)14-25(34)30-21-5-2-19(3-6-21)8-11-32-12-9-20-4-7-24(31-23(20)10-13-32)33-16-26(27,28)17-33/h4,7,15,19,21H,2-3,5-6,8-14,16-17H2,1H3,(H,30,34) |
| InChIKey | KVAJGAADTJZUNF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |