C24H36N4OS2 — CID 138671913
2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-(2-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)ethyl]cyclohexyl]acetamide (PubChem CID 138671913) has the molecular formula C24H36N4OS2 and a molecular weight of 460.71 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-(2-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-(2-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138671913 |
| Molecular Formula | C24H36N4OS2 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-(2-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)ethyl]cyclohexyl]acetamide |
| SMILES | CCCc1nc2c(s1)CCN(CCC1CCC(NC(=O)Cc3cnc(C)s3)CC1)CC2 |
| InChI | InChI=1S/C24H36N4OS2/c1-3-4-24-27-21-10-13-28(14-11-22(21)31-24)12-9-18-5-7-19(8-6-18)26-23(29)15-20-16-25-17(2)30-20/h16,18-19H,3-15H2,1-2H3,(H,26,29) |
| InChIKey | WSYJJZYEZPJIMW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |