C26H36N4OS — CID 138670739
N-[4-[2-(2-cyclopropyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 138670739) has the molecular formula C26H36N4OS and a molecular weight of 452.67 g/mol. Its IUPAC name is N-[4-[2-(2-cyclopropyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[4-[2-(2-cyclopropyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 138670739 |
| Molecular Formula | C26H36N4OS |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | N-[4-[2-(2-cyclopropyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl)ethyl]cyclohexyl]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ncc(CC(=O)NC2CCC(CCN3CCc4ccc(C5CC5)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C26H36N4OS/c1-18-27-17-23(32-18)16-26(31)28-22-7-2-19(3-8-22)10-13-30-14-11-21-6-9-24(20-4-5-20)29-25(21)12-15-30/h6,9,17,19-20,22H,2-5,7-8,10-16H2,1H3,(H,28,31) |
| InChIKey | DDZDAEYFSGXDMU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |