C25H33FN4O2S — CID 145452041
N-[[4-[2-[2-(fluoromethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-2-(2-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 145452041) has the molecular formula C25H33FN4O2S and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[[4-[2-[2-(fluoromethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-2-(2-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[[4-[2-[2-(fluoromethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 145452041 |
| Molecular Formula | C25H33FN4O2S |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | N-[[4-[2-[2-(fluoromethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-2-(2-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ncc(CC(=O)/N=C/C2CCC(CCN3CCc4ccc(OCF)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C25H33FN4O2S/c1-18-27-16-22(33-18)14-24(31)28-15-20-4-2-19(3-5-20)8-11-30-12-9-21-6-7-25(32-17-26)29-23(21)10-13-30/h6-7,15-16,19-20H,2-5,8-14,17H2,1H3/b28-15+ |
| InChIKey | JPOOSDLICWYEQQ-RWPZCVJISA-N |
| XLogP | 4.59 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|