C24H32F2N4O3S — CID 155347353
N-[[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]-2-(5-methyl-1,3-oxazol-2-yl)acetamide (PubChem CID 155347353) has the molecular formula C24H32F2N4O3S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]-2-(5-methyl-1,3-oxazol-2-yl)acetamide.
| Compound Name | N-[[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]-2-(5-methyl-1,3-oxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 155347353 |
| Molecular Formula | C24H32F2N4O3S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]methylidene]-2-(5-methyl-1,3-oxazol-2-yl)acetamide |
| SMILES | Cc1cnc(CC(=O)/N=C/C2CCC(CCN3CCc4nc(OCC(F)F)sc4CC3)CC2)o1 |
| InChI | InChI=1S/C24H32F2N4O3S/c1-16-13-28-23(33-16)12-22(31)27-14-18-4-2-17(3-5-18)6-9-30-10-7-19-20(8-11-30)34-24(29-19)32-15-21(25)26/h13-14,17-18,21H,2-12,15H2,1H3/b27-14+ |
| InChIKey | LGABBMDFYIDZMH-MZJWZYIUSA-N |
| XLogP | 4.52 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|