C28H36F2N4O2S — CID 145451298
(E)-N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 145451298) has the molecular formula C28H36F2N4O2S and a molecular weight of 530.69 g/mol. Its IUPAC name is (E)-N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 145451298 |
| Molecular Formula | C28H36F2N4O2S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (E)-N-[[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)/N=C/C2CCC(CCN3CCc4ccc(OCC(C)(F)F)nc4CC3)CC2)cs1 |
| InChI | InChI=1S/C28H36F2N4O2S/c1-20-32-24(18-37-20)8-9-26(35)31-17-22-5-3-21(4-6-22)11-14-34-15-12-23-7-10-27(33-25(23)13-16-34)36-19-28(2,29)30/h7-10,17-18,21-22H,3-6,11-16,19H2,1-2H3/b9-8+,31-17+ |
| InChIKey | NSKRIBAGFYDECE-MHMSLQBRSA-N |
| XLogP | 5.79 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|