C27H37F3N4O2 — CID 159889327
1-[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(3-fluoro-1-methylpyrazol-4-yl)propan-2-one (PubChem CID 159889327) has the molecular formula C27H37F3N4O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(3-fluoro-1-methylpyrazol-4-yl)propan-2-one.
| Compound Name | 1-[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(3-fluoro-1-methylpyrazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 159889327 |
| Molecular Formula | C27H37F3N4O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 1-[4-[2-[2-(2,2-difluoropropoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(3-fluoro-1-methylpyrazol-4-yl)propan-2-one |
| SMILES | Cn1cc(CC(=O)CC2CCC(CCN3CCc4ccc(OCC(C)(F)F)nc4CC3)CC2)c(F)n1 |
| InChI | InChI=1S/C27H37F3N4O2/c1-27(29,30)18-36-25-8-7-21-10-13-34(14-11-24(21)31-25)12-9-19-3-5-20(6-4-19)15-23(35)16-22-17-33(2)32-26(22)28/h7-8,17,19-20H,3-6,9-16,18H2,1-2H3 |
| InChIKey | NUNSHOQMWBQTAE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |