C28H36F3N5O — CID 155347507
2-(2-methylpyrimidin-5-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]acetamide (PubChem CID 155347507) has the molecular formula C28H36F3N5O and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-(2-methylpyrimidin-5-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]acetamide.
| Compound Name | 2-(2-methylpyrimidin-5-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]acetamide |
|---|---|
| PubChem CID | 155347507 |
| Molecular Formula | C28H36F3N5O |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-(2-methylpyrimidin-5-yl)-N-[[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]methylidene]acetamide |
| SMILES | Cc1ncc(CC(=O)/N=C/C2CCC(CCN3CCc4ccc(CCC(F)(F)F)nc4CC3)CC2)cn1 |
| InChI | InChI=1S/C28H36F3N5O/c1-20-32-18-23(19-33-20)16-27(37)34-17-22-4-2-21(3-5-22)9-13-36-14-10-24-6-7-25(8-12-28(29,30)31)35-26(24)11-15-36/h6-7,17-19,21-22H,2-5,8-16H2,1H3/b34-17+ |
| InChIKey | FQIFJMAITAOMHA-KVAAJVFYSA-N |
| XLogP | 5.11 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|