C26H35F3N4OS — CID 147701405
1-(2-methyl-1,3-thiazol-5-yl)-3-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]propan-2-one (PubChem CID 147701405) has the molecular formula C26H35F3N4OS and a molecular weight of 508.65 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-5-yl)-3-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]propan-2-one.
| Compound Name | 1-(2-methyl-1,3-thiazol-5-yl)-3-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 147701405 |
| Molecular Formula | C26H35F3N4OS |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-5-yl)-3-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]propan-2-one |
| SMILES | Cc1ncc(CC(=O)CC2CCC(CCN3CCc4cnc(CCC(F)(F)F)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C26H35F3N4OS/c1-18-30-17-23(35-18)15-22(34)14-20-4-2-19(3-5-20)7-11-33-12-8-21-16-31-25(6-10-26(27,28)29)32-24(21)9-13-33/h16-17,19-20H,2-15H2,1H3 |
| InChIKey | GSXOERRAOBLTAL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |