C15H23N3O4 — CID 138673887
3,4-diethyl-4-piperazin-1-yl-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 138673887) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3,4-diethyl-4-piperazin-1-yl-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | 3,4-diethyl-4-piperazin-1-yl-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 138673887 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3,4-diethyl-4-piperazin-1-yl-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | CCC1=C(C(=O)O)NC(C(=O)O)=CC1(CC)N1CCNCC1 |
| InChI | InChI=1S/C15H23N3O4/c1-3-10-12(14(21)22)17-11(13(19)20)9-15(10,4-2)18-7-5-16-6-8-18/h9,16-17H,3-8H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | YVMGFNKPUQCIPX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |