C15H24N4O3 — CID 138676004
[2-methyl-1-[1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazol-4-yl]propyl]carbamoyl formate (PubChem CID 138676004) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is [2-methyl-1-[1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazol-4-yl]propyl]carbamoyl formate.
| Compound Name | [2-methyl-1-[1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazol-4-yl]propyl]carbamoyl formate |
|---|---|
| PubChem CID | 138676004 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [2-methyl-1-[1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazol-4-yl]propyl]carbamoyl formate |
| SMILES | CC(C)C(NC(=O)OC=O)c1cn(C[C@@H]2CCN(C)C2)cn1 |
| InChI | InChI=1S/C15H24N4O3/c1-11(2)14(17-15(21)22-10-20)13-8-19(9-16-13)7-12-4-5-18(3)6-12/h8-12,14H,4-7H2,1-3H3,(H,17,21)/t12-,14?/m1/s1 |
| InChIKey | BEPUUIXKMRWCFR-PUODRLBUSA-N |
| XLogP | 1.41 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|