C10H17N3 — CID 89147179
4-methyl-1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazole (PubChem CID 89147179) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-methyl-1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazole.
| Compound Name | 4-methyl-1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazole |
|---|---|
| PubChem CID | 89147179 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-methyl-1-[[(3R)-1-methylpyrrolidin-3-yl]methyl]imidazole |
| SMILES | Cc1cn(C[C@@H]2CCN(C)C2)cn1 |
| InChI | InChI=1S/C10H17N3/c1-9-5-13(8-11-9)7-10-3-4-12(2)6-10/h5,8,10H,3-4,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | IYVYKWAMVAZKME-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |