C11H16F2O4 — CID 138677003
dipropyl 2-(2,2-difluoroethylidene)propanedioate (PubChem CID 138677003) has the molecular formula C11H16F2O4 and a molecular weight of 250.24 g/mol. Its IUPAC name is dipropyl 2-(2,2-difluoroethylidene)propanedioate.
| Compound Name | dipropyl 2-(2,2-difluoroethylidene)propanedioate |
|---|---|
| PubChem CID | 138677003 |
| Molecular Formula | C11H16F2O4 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | dipropyl 2-(2,2-difluoroethylidene)propanedioate |
| SMILES | CCCOC(=O)C(=CC(F)F)C(=O)OCCC |
| InChI | InChI=1S/C11H16F2O4/c1-3-5-16-10(14)8(7-9(12)13)11(15)17-6-4-2/h7,9H,3-6H2,1-2H3 |
| InChIKey | XRAJXGVMAQGHMV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|