C17H18ClF2N3O2S — CID 138680502
2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 138680502) has the molecular formula C17H18ClF2N3O2S and a molecular weight of 401.87 g/mol. Its IUPAC name is 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 138680502 |
| Molecular Formula | C17H18ClF2N3O2S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1[nH]c(=S)n2c1CC(c1c(F)ccc(Cl)c1F)C2 |
| InChI | InChI=1S/C17H18ClF2N3O2S/c1-25-5-4-21-14(24)7-12-13-6-9(8-23(13)17(26)22-12)15-11(19)3-2-10(18)16(15)20/h2-3,9H,4-8H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | UWZLDJQLOPPIAM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|