C20H17BrF2N4OS — CID 138680496
2-[6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 138680496) has the molecular formula C20H17BrF2N4OS and a molecular weight of 479.35 g/mol. Its IUPAC name is 2-[6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 138680496 |
| Molecular Formula | C20H17BrF2N4OS |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2-[6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1[nH]c(=S)n2c1CC(c1c(F)ccc(Br)c1F)C2)NCc1ccccn1 |
| InChI | InChI=1S/C20H17BrF2N4OS/c21-13-4-5-14(22)18(19(13)23)11-7-16-15(26-20(29)27(16)10-11)8-17(28)25-9-12-3-1-2-6-24-12/h1-6,11H,7-10H2,(H,25,28)(H,26,29) |
| InChIKey | QCAWDDIDRJVUOW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|