C19H22ClF4N3S — CID 162717788
(6R)-1-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride (PubChem CID 162717788) has the molecular formula C19H22ClF4N3S and a molecular weight of 435.92 g/mol. Its IUPAC name is (6R)-1-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride.
| Compound Name | (6R)-1-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride |
|---|---|
| PubChem CID | 162717788 |
| Molecular Formula | C19H22ClF4N3S |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (6R)-1-[3-[(3R)-3-fluoropyrrolidin-1-yl]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride |
| SMILES | Cl.Fc1ccc(F)c([C@H]2Cc3c(CCCN4CC[C@@H](F)C4)[nH]c(=S)n3C2)c1F |
| InChI | InChI=1S/C19H21F4N3S.ClH/c20-12-5-7-25(10-12)6-1-2-15-16-8-11(9-26(16)19(27)24-15)17-13(21)3-4-14(22)18(17)23;/h3-4,11-12H,1-2,5-10H2,(H,24,27);1H/t11-,12+;/m0./s1 |
| InChIKey | DLILHRZNYWHBLO-ZVWHLABXSA-N |
| XLogP | 4.70 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|